C33H37N3O6S — CID 54591269
2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-4-(2-ethenylsulfonylethylcarbamoyl)benzoate (PubChem CID 54591269) has the molecular formula C33H37N3O6S and a molecular weight of 603.74 g/mol. Its IUPAC name is 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-4-(2-ethenylsulfonylethylcarbamoyl)benzoate.
| Compound Name | 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-4-(2-ethenylsulfonylethylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 54591269 |
| Molecular Formula | C33H37N3O6S |
| Molecular Weight | 603.74 g/mol |
| Exact Mass | 603.24 |
| IUPAC Name | 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-4-(2-ethenylsulfonylethylcarbamoyl)benzoate |
| SMILES | C=CS(=O)(=O)CCNC(=O)c1ccc(C(=O)[O-])c(-c2c3ccc(=[N+](CC)CC)cc-3oc3cc(N(CC)CC)ccc23)c1 |
| InChI | InChI=1S/C33H37N3O6S/c1-6-35(7-2)23-12-15-26-29(20-23)42-30-21-24(36(8-3)9-4)13-16-27(30)31(26)28-19-22(11-14-25(28)33(38)39)32(37)34-17-18-43(40,41)10-5/h10-16,19-21H,5-9,17-18H2,1-4H3,(H-,34,37,38,39) |
| InChIKey | XLQUCLKLGSZMBA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.74 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|