C29H29N2Na2O5+ — CID 101124829
disodium;2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]terephthalate (PubChem CID 101124829) has the molecular formula C29H29N2Na2O5+ and a molecular weight of 531.54 g/mol. Its IUPAC name is disodium;2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]terephthalate.
| Compound Name | disodium;2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]terephthalate |
|---|---|
| PubChem CID | 101124829 |
| Molecular Formula | C29H29N2Na2O5+ |
| Molecular Weight | 531.54 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | disodium;2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]terephthalate |
| SMILES | CCN(CC)c1ccc2c(-c3cc(C(=O)[O-])ccc3C(=O)[O-])c3ccc(=[N+](CC)CC)cc-3oc2c1.[Na+].[Na+] |
| InChI | InChI=1S/C29H30N2O5.2Na/c1-5-30(6-2)19-10-13-22-25(16-19)36-26-17-20(31(7-3)8-4)11-14-23(26)27(22)24-15-18(28(32)33)9-12-21(24)29(34)35;;/h9-17H,5-8H2,1-4H3,(H-,32,33,34,35);;/q;2*+1/p-1 |
| InChIKey | FXGBVPWHRMTTLW-UHFFFAOYSA-M |
| XLogP | -3.40 |
| TPSA | 99.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.54 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|