C27H30ClN2O3S2+ — CID 122696546
[9-(4-chlorosulfonyl-2-sulfanylphenyl)-6-(diethylamino)xanthen-3-ylidene]-diethylazanium (PubChem CID 122696546) has the molecular formula C27H30ClN2O3S2+ and a molecular weight of 530.14 g/mol. Its IUPAC name is [9-(4-chlorosulfonyl-2-sulfanylphenyl)-6-(diethylamino)xanthen-3-ylidene]-diethylazanium.
| Compound Name | [9-(4-chlorosulfonyl-2-sulfanylphenyl)-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 122696546 |
| Molecular Formula | C27H30ClN2O3S2+ |
| Molecular Weight | 530.14 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | [9-(4-chlorosulfonyl-2-sulfanylphenyl)-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccc(S(=O)(=O)Cl)cc3S)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C27H29ClN2O3S2/c1-5-29(6-2)18-9-12-21-24(15-18)33-25-16-19(30(7-3)8-4)10-13-22(25)27(21)23-14-11-20(17-26(23)34)35(28,31)32/h9-17H,5-8H2,1-4H3/p+1 |
| InChIKey | POSGWJKMWKOUOQ-UHFFFAOYSA-O |
| XLogP | 6.08 |
| TPSA | 53.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.14 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|