C28H30ClN3O5 — CID 138400364
2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-4-nitrobenzoate;hydrochloride (PubChem CID 138400364) has the molecular formula C28H30ClN3O5 and a molecular weight of 524.02 g/mol. Its IUPAC name is 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-4-nitrobenzoate;hydrochloride.
| Compound Name | 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-4-nitrobenzoate;hydrochloride |
|---|---|
| PubChem CID | 138400364 |
| Molecular Formula | C28H30ClN3O5 |
| Molecular Weight | 524.02 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-4-nitrobenzoate;hydrochloride |
| SMILES | CCN(CC)c1ccc2c(-c3cc([N+](=O)[O-])ccc3C(=O)[O-])c3ccc(=[N+](CC)CC)cc-3oc2c1.Cl |
| InChI | InChI=1S/C28H29N3O5.ClH/c1-5-29(6-2)18-9-13-22-25(16-18)36-26-17-19(30(7-3)8-4)10-14-23(26)27(22)24-15-20(31(34)35)11-12-21(24)28(32)33;/h9-17H,5-8H2,1-4H3;1H |
| InChIKey | BAEITEFYZPQDEA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 102.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.02 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|