C35H36N5O4+ — CID 102230952
[6-(diethylamino)-9-[2-[[(4-nitrophenyl)methylideneamino]carbamoyl]phenyl]xanthen-3-ylidene]-diethylazanium (PubChem CID 102230952) has the molecular formula C35H36N5O4+ and a molecular weight of 590.70 g/mol. Its IUPAC name is [6-(diethylamino)-9-[2-[[(4-nitrophenyl)methylideneamino]carbamoyl]phenyl]xanthen-3-ylidene]-diethylazanium.
| Compound Name | [6-(diethylamino)-9-[2-[[(4-nitrophenyl)methylideneamino]carbamoyl]phenyl]xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 102230952 |
| Molecular Formula | C35H36N5O4+ |
| Molecular Weight | 590.70 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | [6-(diethylamino)-9-[2-[[(4-nitrophenyl)methylideneamino]carbamoyl]phenyl]xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccccc3C(=O)NN=Cc3ccc([N+](=O)[O-])cc3)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C35H35N5O4/c1-5-38(6-2)26-17-19-30-32(21-26)44-33-22-27(39(7-3)8-4)18-20-31(33)34(30)28-11-9-10-12-29(28)35(41)37-36-23-24-13-15-25(16-14-24)40(42)43/h9-23H,5-8H2,1-4H3/p+1 |
| InChIKey | YEVFBZVGUAFBAV-UHFFFAOYSA-O |
| XLogP | 6.53 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.70 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|