C32H40N4O6S2 — CID 58729531
4-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-3-(4-methylpiperazin-1-yl)sulfonylbenzenesulfonate (PubChem CID 58729531) has the molecular formula C32H40N4O6S2 and a molecular weight of 640.83 g/mol. Its IUPAC name is 4-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-3-(4-methylpiperazin-1-yl)sulfonylbenzenesulfonate.
| Compound Name | 4-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-3-(4-methylpiperazin-1-yl)sulfonylbenzenesulfonate |
|---|---|
| PubChem CID | 58729531 |
| Molecular Formula | C32H40N4O6S2 |
| Molecular Weight | 640.83 g/mol |
| Exact Mass | 640.24 |
| IUPAC Name | 4-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-3-(4-methylpiperazin-1-yl)sulfonylbenzenesulfonate |
| SMILES | CCN(CC)c1ccc2c(-c3ccc(S(=O)(=O)[O-])cc3S(=O)(=O)N3CCN(C)CC3)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C32H40N4O6S2/c1-6-34(7-2)23-10-13-26-29(20-23)42-30-21-24(35(8-3)9-4)11-14-27(30)32(26)28-15-12-25(44(39,40)41)22-31(28)43(37,38)36-18-16-33(5)17-19-36/h10-15,20-22H,6-9,16-19H2,1-5H3 |
| InChIKey | PHTXNTVEZRWBGC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 117.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.83 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|