C36H40N4O7S2 — CID 58992328
5-[(1-amino-1-oxo-3-phenylpropan-2-yl)sulfamoyl]-2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]benzenesulfonate (PubChem CID 58992328) has the molecular formula C36H40N4O7S2 and a molecular weight of 704.87 g/mol. Its IUPAC name is 5-[(1-amino-1-oxo-3-phenylpropan-2-yl)sulfamoyl]-2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]benzenesulfonate.
| Compound Name | 5-[(1-amino-1-oxo-3-phenylpropan-2-yl)sulfamoyl]-2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]benzenesulfonate |
|---|---|
| PubChem CID | 58992328 |
| Molecular Formula | C36H40N4O7S2 |
| Molecular Weight | 704.87 g/mol |
| Exact Mass | 704.23 |
| IUPAC Name | 5-[(1-amino-1-oxo-3-phenylpropan-2-yl)sulfamoyl]-2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]benzenesulfonate |
| SMILES | CCN(CC)c1ccc2c(-c3ccc(S(=O)(=O)NC(Cc4ccccc4)C(N)=O)cc3S(=O)(=O)[O-])c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C36H40N4O7S2/c1-5-39(6-2)25-14-17-28-32(21-25)47-33-22-26(40(7-3)8-4)15-18-29(33)35(28)30-19-16-27(23-34(30)49(44,45)46)48(42,43)38-31(36(37)41)20-24-12-10-9-11-13-24/h9-19,21-23,31,38H,5-8,20H2,1-4H3,(H2-,37,41,44,45,46) |
| InChIKey | BMWIOQMGRBUALG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 165.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.87 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|