C30H39N4O8S2+ — CID 132915782
[9-[4-(3-aminooxypropoxysulfamoyl)-2-sulfophenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium (PubChem CID 132915782) has the molecular formula C30H39N4O8S2+ and a molecular weight of 647.80 g/mol. Its IUPAC name is [9-[4-(3-aminooxypropoxysulfamoyl)-2-sulfophenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium.
| Compound Name | [9-[4-(3-aminooxypropoxysulfamoyl)-2-sulfophenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 132915782 |
| Molecular Formula | C30H39N4O8S2+ |
| Molecular Weight | 647.80 g/mol |
| Exact Mass | 647.22 |
| IUPAC Name | [9-[4-(3-aminooxypropoxysulfamoyl)-2-sulfophenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccc(S(=O)(=O)NOCCCON)cc3S(=O)(=O)O)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C30H38N4O8S2/c1-5-33(6-2)21-10-13-24-27(18-21)42-28-19-22(34(7-3)8-4)11-14-25(28)30(24)26-15-12-23(20-29(26)44(37,38)39)43(35,36)32-41-17-9-16-40-31/h10-15,18-20,32H,5-9,16-17,31H2,1-4H3/p+1 |
| InChIKey | GEGHCMTXPPFMPO-UHFFFAOYSA-O |
| XLogP | 3.60 |
| TPSA | 164.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.80 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|