C29H37N4O11S4+ — CID 87584363
[9-(2,4-disulfophenyl)-6-[ethyl-[2-(methanesulfonamido)ethyl]amino]xanthen-3-ylidene]-ethyl-[2-(methanesulfonamido)ethyl]azanium (PubChem CID 87584363) has the molecular formula C29H37N4O11S4+ and a molecular weight of 745.90 g/mol. Its IUPAC name is [9-(2,4-disulfophenyl)-6-[ethyl-[2-(methanesulfonamido)ethyl]amino]xanthen-3-ylidene]-ethyl-[2-(methanesulfonamido)ethyl]azanium.
| Compound Name | [9-(2,4-disulfophenyl)-6-[ethyl-[2-(methanesulfonamido)ethyl]amino]xanthen-3-ylidene]-ethyl-[2-(methanesulfonamido)ethyl]azanium |
|---|---|
| PubChem CID | 87584363 |
| Molecular Formula | C29H37N4O11S4+ |
| Molecular Weight | 745.90 g/mol |
| Exact Mass | 745.13 |
| IUPAC Name | [9-(2,4-disulfophenyl)-6-[ethyl-[2-(methanesulfonamido)ethyl]amino]xanthen-3-ylidene]-ethyl-[2-(methanesulfonamido)ethyl]azanium |
| SMILES | CCN(CCNS(C)(=O)=O)c1ccc2c(-c3ccc(S(=O)(=O)O)cc3S(=O)(=O)O)c3cc/c(=[N+](\CC)CCNS(C)(=O)=O)cc-3oc2c1 |
| InChI | InChI=1S/C29H36N4O11S4/c1-5-32(15-13-30-45(3,34)35)20-7-10-23-26(17-20)44-27-18-21(33(6-2)16-14-31-46(4,36)37)8-11-24(27)29(23)25-12-9-22(47(38,39)40)19-28(25)48(41,42)43/h7-12,17-19,30-31H,5-6,13-16H2,1-4H3,(H-,38,39,40,41,42,43)/p+1 |
| InChIKey | VKFLRGYLSKUPSW-UHFFFAOYSA-O |
| XLogP | 1.41 |
| TPSA | 220.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.90 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|