C31H41N2O7SSi+ — CID 164776745
[6-(diethylamino)-9-(2-sulfophenyl)xanthen-3-ylidene]-ethyl-(3-trimethoxysilylpropyl)azanium (PubChem CID 164776745) has the molecular formula C31H41N2O7SSi+ and a molecular weight of 613.83 g/mol. Its IUPAC name is [6-(diethylamino)-9-(2-sulfophenyl)xanthen-3-ylidene]-ethyl-(3-trimethoxysilylpropyl)azanium.
| Compound Name | [6-(diethylamino)-9-(2-sulfophenyl)xanthen-3-ylidene]-ethyl-(3-trimethoxysilylpropyl)azanium |
|---|---|
| PubChem CID | 164776745 |
| Molecular Formula | C31H41N2O7SSi+ |
| Molecular Weight | 613.83 g/mol |
| Exact Mass | 613.24 |
| IUPAC Name | [6-(diethylamino)-9-(2-sulfophenyl)xanthen-3-ylidene]-ethyl-(3-trimethoxysilylpropyl)azanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccccc3S(=O)(=O)O)c3cc/c(=[N+](/CC)CCC[Si](OC)(OC)OC)cc-3oc2c1 |
| InChI | InChI=1S/C31H40N2O7SSi/c1-7-32(8-2)23-15-17-25-28(21-23)40-29-22-24(33(9-3)19-12-20-42(37-4,38-5)39-6)16-18-26(29)31(25)27-13-10-11-14-30(27)41(34,35)36/h10-11,13-18,21-22H,7-9,12,19-20H2,1-6H3/p+1 |
| InChIKey | BZUXGDJADGLNEY-UHFFFAOYSA-O |
| XLogP | 5.36 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.83 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|