C35H51N2O10SSi2+ — CID 164776767
[6-(diethylamino)-9-(2-sulfophenyl)xanthen-3-ylidene]-bis(3-trimethoxysilylpropyl)azanium (PubChem CID 164776767) has the molecular formula C35H51N2O10SSi2+ and a molecular weight of 748.04 g/mol. Its IUPAC name is [6-(diethylamino)-9-(2-sulfophenyl)xanthen-3-ylidene]-bis(3-trimethoxysilylpropyl)azanium.
| Compound Name | [6-(diethylamino)-9-(2-sulfophenyl)xanthen-3-ylidene]-bis(3-trimethoxysilylpropyl)azanium |
|---|---|
| PubChem CID | 164776767 |
| Molecular Formula | C35H51N2O10SSi2+ |
| Molecular Weight | 748.04 g/mol |
| Exact Mass | 747.28 |
| IUPAC Name | [6-(diethylamino)-9-(2-sulfophenyl)xanthen-3-ylidene]-bis(3-trimethoxysilylpropyl)azanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccccc3S(=O)(=O)O)c3ccc(=[N+](CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC)cc-3oc2c1 |
| InChI | InChI=1S/C35H50N2O10SSi2/c1-9-36(10-2)27-17-19-29-32(25-27)47-33-26-28(18-20-30(33)35(29)31-15-11-12-16-34(31)48(38,39)40)37(21-13-23-49(41-3,42-4)43-5)22-14-24-50(44-6,45-7)46-8/h11-12,15-20,25-26H,9-10,13-14,21-24H2,1-8H3/p+1 |
| InChIKey | JMXPTZSQPQRVFD-UHFFFAOYSA-O |
| XLogP | 5.61 |
| TPSA | 129.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.04 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|