C31H39N2O6SSi+ — CID 164776715
[6-(diethylamino)-9-(2-sulfophenyl)xanthen-3-ylidene]-methyl-[2-oxo-2-(2-trimethylsilylethoxy)ethyl]azanium (PubChem CID 164776715) has the molecular formula C31H39N2O6SSi+ and a molecular weight of 595.81 g/mol. Its IUPAC name is [6-(diethylamino)-9-(2-sulfophenyl)xanthen-3-ylidene]-methyl-[2-oxo-2-(2-trimethylsilylethoxy)ethyl]azanium.
| Compound Name | [6-(diethylamino)-9-(2-sulfophenyl)xanthen-3-ylidene]-methyl-[2-oxo-2-(2-trimethylsilylethoxy)ethyl]azanium |
|---|---|
| PubChem CID | 164776715 |
| Molecular Formula | C31H39N2O6SSi+ |
| Molecular Weight | 595.81 g/mol |
| Exact Mass | 595.23 |
| IUPAC Name | [6-(diethylamino)-9-(2-sulfophenyl)xanthen-3-ylidene]-methyl-[2-oxo-2-(2-trimethylsilylethoxy)ethyl]azanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccccc3S(=O)(=O)O)c3cc/c(=[N+](/C)CC(=O)OCC[Si](C)(C)C)cc-3oc2c1 |
| InChI | InChI=1S/C31H38N2O6SSi/c1-7-33(8-2)23-14-16-25-28(20-23)39-27-19-22(32(3)21-30(34)38-17-18-41(4,5)6)13-15-24(27)31(25)26-11-9-10-12-29(26)40(35,36)37/h9-16,19-20H,7-8,17-18,21H2,1-6H3/p+1 |
| InChIKey | VUIDLVGVTMRHQS-UHFFFAOYSA-O |
| XLogP | 5.58 |
| TPSA | 100.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.81 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|