C37H35N2O4S+ — CID 165341966
(2,3-dimethylphenyl)-methyl-[9-(2-sulfophenyl)-6-(N,2,3-trimethylanilino)xanthen-3-ylidene]azanium (PubChem CID 165341966) has the molecular formula C37H35N2O4S+ and a molecular weight of 603.76 g/mol. Its IUPAC name is (2,3-dimethylphenyl)-methyl-[9-(2-sulfophenyl)-6-(N,2,3-trimethylanilino)xanthen-3-ylidene]azanium.
| Compound Name | (2,3-dimethylphenyl)-methyl-[9-(2-sulfophenyl)-6-(N,2,3-trimethylanilino)xanthen-3-ylidene]azanium |
|---|---|
| PubChem CID | 165341966 |
| Molecular Formula | C37H35N2O4S+ |
| Molecular Weight | 603.76 g/mol |
| Exact Mass | 603.23 |
| IUPAC Name | (2,3-dimethylphenyl)-methyl-[9-(2-sulfophenyl)-6-(N,2,3-trimethylanilino)xanthen-3-ylidene]azanium |
| SMILES | Cc1cccc(N(C)c2ccc3c(-c4ccccc4S(=O)(=O)O)c4cc/c(=[N+](/C)c5cccc(C)c5C)cc-4oc3c2)c1C |
| InChI | InChI=1S/C37H34N2O4S/c1-23-11-9-14-32(25(23)3)38(5)27-17-19-29-34(21-27)43-35-22-28(39(6)33-15-10-12-24(2)26(33)4)18-20-30(35)37(29)31-13-7-8-16-36(31)44(40,41)42/h7-22H,1-6H3/p+1 |
| InChIKey | MBTIILAMJQVBGK-UHFFFAOYSA-O |
| XLogP | 8.19 |
| TPSA | 73.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.76 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|