C27H22N2O4S — CID 130206640
2-[3-amino-6-(2,6-dimethylphenyl)iminoxanthen-9-yl]benzenesulfonic acid (PubChem CID 130206640) has the molecular formula C27H22N2O4S and a molecular weight of 470.55 g/mol. Its IUPAC name is 2-[3-amino-6-(2,6-dimethylphenyl)iminoxanthen-9-yl]benzenesulfonic acid.
| Compound Name | 2-[3-amino-6-(2,6-dimethylphenyl)iminoxanthen-9-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 130206640 |
| Molecular Formula | C27H22N2O4S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 2-[3-amino-6-(2,6-dimethylphenyl)iminoxanthen-9-yl]benzenesulfonic acid |
| SMILES | Cc1cccc(C)c1/N=c1\ccc2c(-c3ccccc3S(=O)(=O)O)c3ccc(N)cc3oc-2c1 |
| InChI | InChI=1S/C27H22N2O4S/c1-16-6-5-7-17(2)27(16)29-19-11-13-21-24(15-19)33-23-14-18(28)10-12-20(23)26(21)22-8-3-4-9-25(22)34(30,31)32/h3-15H,28H2,1-2H3,(H,30,31,32)/b29-19+ |
| InChIKey | ZLRFGJAKRHFRLY-VUTHCHCSSA-N |
| XLogP | 5.88 |
| TPSA | 105.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|