C39H36N4O12S3 — CID 130193469
3-formamido-5-[[6-(3-formamido-2,4,6-trimethyl-5-sulfophenyl)imino-9-(2-sulfophenyl)xanthen-3-yl]amino]-2,4,6-trimethylbenzenesulfonic acid (PubChem CID 130193469) has the molecular formula C39H36N4O12S3 and a molecular weight of 848.93 g/mol. Its IUPAC name is 3-formamido-5-[[6-(3-formamido-2,4,6-trimethyl-5-sulfophenyl)imino-9-(2-sulfophenyl)xanthen-3-yl]amino]-2,4,6-trimethylbenzenesulfonic acid.
| Compound Name | 3-formamido-5-[[6-(3-formamido-2,4,6-trimethyl-5-sulfophenyl)imino-9-(2-sulfophenyl)xanthen-3-yl]amino]-2,4,6-trimethylbenzenesulfonic acid |
|---|---|
| PubChem CID | 130193469 |
| Molecular Formula | C39H36N4O12S3 |
| Molecular Weight | 848.93 g/mol |
| Exact Mass | 848.15 |
| IUPAC Name | 3-formamido-5-[[6-(3-formamido-2,4,6-trimethyl-5-sulfophenyl)imino-9-(2-sulfophenyl)xanthen-3-yl]amino]-2,4,6-trimethylbenzenesulfonic acid |
| SMILES | Cc1c(/N=c2\ccc3c(-c4ccccc4S(=O)(=O)O)c4ccc(Nc5c(C)c(NC=O)c(C)c(S(=O)(=O)O)c5C)cc4oc-3c2)c(C)c(S(=O)(=O)O)c(C)c1NC=O |
| InChI | InChI=1S/C39H36N4O12S3/c1-19-34(40-17-44)21(3)38(57(49,50)51)23(5)36(19)42-25-11-13-27-30(15-25)55-31-16-26(12-14-28(31)33(27)29-9-7-8-10-32(29)56(46,47)48)43-37-20(2)35(41-18-45)22(4)39(24(37)6)58(52,53)54/h7-18,42H,1-6H3,(H,40,44)(H,41,45)(H,46,47,48)(H,49,50,51)(H,52,53,54)/b43-26+ |
| InChIKey | VFWTZIPKBXKHPW-BCBUBDITSA-N |
| XLogP | 6.91 |
| TPSA | 258.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.93 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|