C52H44N4O8S — CID 58194046
2-[[3-[[6-(3-benzamido-2,4,6-trimethylphenyl)imino-9-(2-sulfophenyl)xanthen-3-yl]amino]-2,4,6-trimethylphenyl]carbamoyl]benzoic acid (PubChem CID 58194046) has the molecular formula C52H44N4O8S and a molecular weight of 885.01 g/mol. Its IUPAC name is 2-[[3-[[6-(3-benzamido-2,4,6-trimethylphenyl)imino-9-(2-sulfophenyl)xanthen-3-yl]amino]-2,4,6-trimethylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[3-[[6-(3-benzamido-2,4,6-trimethylphenyl)imino-9-(2-sulfophenyl)xanthen-3-yl]amino]-2,4,6-trimethylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 58194046 |
| Molecular Formula | C52H44N4O8S |
| Molecular Weight | 885.01 g/mol |
| Exact Mass | 884.29 |
| IUPAC Name | 2-[[3-[[6-(3-benzamido-2,4,6-trimethylphenyl)imino-9-(2-sulfophenyl)xanthen-3-yl]amino]-2,4,6-trimethylphenyl]carbamoyl]benzoic acid |
| SMILES | Cc1cc(C)c(NC(=O)c2ccccc2)c(C)c1/N=c1\ccc2c(-c3ccccc3S(=O)(=O)O)c3ccc(Nc4c(C)cc(C)c(NC(=O)c5ccccc5C(=O)O)c4C)cc3oc-2c1 |
| InChI | InChI=1S/C52H44N4O8S/c1-28-24-30(3)48(55-50(57)34-14-8-7-9-15-34)32(5)46(28)53-35-20-22-39-42(26-35)64-43-27-36(21-23-40(43)45(39)41-18-12-13-19-44(41)65(61,62)63)54-47-29(2)25-31(4)49(33(47)6)56-51(58)37-16-10-11-17-38(37)52(59)60/h7-27,54H,1-6H3,(H,55,57)(H,56,58)(H,59,60)(H,61,62,63)/b53-35+ |
| InChIKey | QCLQRLKMRYIWHY-XRVUAAMPSA-N |
| XLogP | 11.48 |
| TPSA | 187.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.01 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|