C31H22N2O7S2 — CID 149003458
2-[3-phenylimino-6-(3-sulfoanilino)xanthen-9-yl]benzenesulfonic acid (PubChem CID 149003458) has the molecular formula C31H22N2O7S2 and a molecular weight of 598.66 g/mol. Its IUPAC name is 2-[3-phenylimino-6-(3-sulfoanilino)xanthen-9-yl]benzenesulfonic acid.
| Compound Name | 2-[3-phenylimino-6-(3-sulfoanilino)xanthen-9-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 149003458 |
| Molecular Formula | C31H22N2O7S2 |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.09 |
| IUPAC Name | 2-[3-phenylimino-6-(3-sulfoanilino)xanthen-9-yl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cccc(Nc2ccc3c(-c4ccccc4S(=O)(=O)O)c4cc/c(=N\c5ccccc5)cc-4oc3c2)c1 |
| InChI | InChI=1S/C31H22N2O7S2/c34-41(35,36)24-10-6-9-21(17-24)33-23-14-16-26-29(19-23)40-28-18-22(32-20-7-2-1-3-8-20)13-15-25(28)31(26)27-11-4-5-12-30(27)42(37,38)39/h1-19,33H,(H,34,35,36)(H,37,38,39)/b32-22+ |
| InChIKey | VCSYOTFZZOMPSY-WEMUVCOSSA-N |
| XLogP | 6.67 |
| TPSA | 146.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|