C28H22N2O6S — CID 10075181
2-[3-methylimino-6-(2-methyl-4-sulfoanilino)xanthen-9-yl]benzoic acid (PubChem CID 10075181) has the molecular formula C28H22N2O6S and a molecular weight of 514.56 g/mol. Its IUPAC name is 2-[3-methylimino-6-(2-methyl-4-sulfoanilino)xanthen-9-yl]benzoic acid.
| Compound Name | 2-[3-methylimino-6-(2-methyl-4-sulfoanilino)xanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 10075181 |
| Molecular Formula | C28H22N2O6S |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | 2-[3-methylimino-6-(2-methyl-4-sulfoanilino)xanthen-9-yl]benzoic acid |
| SMILES | C/N=c1\ccc2c(-c3ccccc3C(=O)O)c3ccc(Nc4ccc(S(=O)(=O)O)cc4C)cc3oc-2c1 |
| InChI | InChI=1S/C28H22N2O6S/c1-16-13-19(37(33,34)35)9-12-24(16)30-18-8-11-23-26(15-18)36-25-14-17(29-2)7-10-22(25)27(23)20-5-3-4-6-21(20)28(31)32/h3-15,30H,1-2H3,(H,31,32)(H,33,34,35)/b29-17+ |
| InChIKey | JGGYIJVRRBGDKN-STBIYBPSSA-N |
| XLogP | 5.73 |
| TPSA | 129.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|