C43H43N2O5S+ — CID 87738892
[6-(2-methylanilino)-9-[2-[(3,7,7-trimethyl-1-bicyclo[4.1.0]heptanyl)oxy]phenyl]xanthen-3-ylidene]-(2-methyl-4-sulfophenyl)azanium (PubChem CID 87738892) has the molecular formula C43H43N2O5S+ and a molecular weight of 699.89 g/mol. Its IUPAC name is [6-(2-methylanilino)-9-[2-[(3,7,7-trimethyl-1-bicyclo[4.1.0]heptanyl)oxy]phenyl]xanthen-3-ylidene]-(2-methyl-4-sulfophenyl)azanium.
| Compound Name | [6-(2-methylanilino)-9-[2-[(3,7,7-trimethyl-1-bicyclo[4.1.0]heptanyl)oxy]phenyl]xanthen-3-ylidene]-(2-methyl-4-sulfophenyl)azanium |
|---|---|
| PubChem CID | 87738892 |
| Molecular Formula | C43H43N2O5S+ |
| Molecular Weight | 699.89 g/mol |
| Exact Mass | 699.29 |
| IUPAC Name | [6-(2-methylanilino)-9-[2-[(3,7,7-trimethyl-1-bicyclo[4.1.0]heptanyl)oxy]phenyl]xanthen-3-ylidene]-(2-methyl-4-sulfophenyl)azanium |
| SMILES | Cc1ccccc1Nc1ccc2c(-c3ccccc3OC34CC(C)CCC3C4(C)C)c3cc/c(=[NH+]\c4ccc(S(=O)(=O)O)cc4C)cc-3oc2c1 |
| InChI | InChI=1S/C43H42N2O5S/c1-26-14-21-40-42(4,5)43(40,25-26)50-37-13-9-7-11-32(37)41-33-18-15-29(44-35-12-8-6-10-27(35)2)23-38(33)49-39-24-30(16-19-34(39)41)45-36-20-17-31(22-28(36)3)51(46,47)48/h6-13,15-20,22-24,26,40,44H,14,21,25H2,1-5H3,(H,46,47,48)/p+1/b45-30+ |
| InChIKey | OSAYITNQHBPOTP-RPKDBOOMSA-O |
| XLogP | 8.72 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.89 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|