C41H43N2O4S+ — CID 123579874
[6-(2,6-diethyl-4-methylanilino)-9-(2-sulfophenyl)xanthen-3-ylidene]-(2,6-diethyl-4-methylphenyl)azanium (PubChem CID 123579874) has the molecular formula C41H43N2O4S+ and a molecular weight of 659.87 g/mol. Its IUPAC name is [6-(2,6-diethyl-4-methylanilino)-9-(2-sulfophenyl)xanthen-3-ylidene]-(2,6-diethyl-4-methylphenyl)azanium.
| Compound Name | [6-(2,6-diethyl-4-methylanilino)-9-(2-sulfophenyl)xanthen-3-ylidene]-(2,6-diethyl-4-methylphenyl)azanium |
|---|---|
| PubChem CID | 123579874 |
| Molecular Formula | C41H43N2O4S+ |
| Molecular Weight | 659.87 g/mol |
| Exact Mass | 659.29 |
| IUPAC Name | [6-(2,6-diethyl-4-methylanilino)-9-(2-sulfophenyl)xanthen-3-ylidene]-(2,6-diethyl-4-methylphenyl)azanium |
| SMILES | CCc1cc(C)cc(CC)c1Nc1ccc2c(-c3ccccc3S(=O)(=O)O)c3cc/c(=[NH+]\c4c(CC)cc(C)cc4CC)cc-3oc2c1 |
| InChI | InChI=1S/C41H42N2O4S/c1-7-27-19-25(5)20-28(8-2)40(27)42-31-15-17-33-36(23-31)47-37-24-32(43-41-29(9-3)21-26(6)22-30(41)10-4)16-18-34(37)39(33)35-13-11-12-14-38(35)48(44,45)46/h11-24,42H,7-10H2,1-6H3,(H,44,45,46)/p+1/b43-32+ |
| InChIKey | ZKFYVYMAPKJWPC-WUGRJRDASA-O |
| XLogP | 8.37 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.87 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|