C41H37N2O5+ — CID 140765392
[6-(2,6-dimethylanilino)-9-[2-(2-prop-2-enoyloxyethoxycarbonyl)phenyl]xanthen-3-ylidene]-(2,6-dimethylphenyl)azanium (PubChem CID 140765392) has the molecular formula C41H37N2O5+ and a molecular weight of 637.76 g/mol. Its IUPAC name is [6-(2,6-dimethylanilino)-9-[2-(2-prop-2-enoyloxyethoxycarbonyl)phenyl]xanthen-3-ylidene]-(2,6-dimethylphenyl)azanium.
| Compound Name | [6-(2,6-dimethylanilino)-9-[2-(2-prop-2-enoyloxyethoxycarbonyl)phenyl]xanthen-3-ylidene]-(2,6-dimethylphenyl)azanium |
|---|---|
| PubChem CID | 140765392 |
| Molecular Formula | C41H37N2O5+ |
| Molecular Weight | 637.76 g/mol |
| Exact Mass | 637.27 |
| IUPAC Name | [6-(2,6-dimethylanilino)-9-[2-(2-prop-2-enoyloxyethoxycarbonyl)phenyl]xanthen-3-ylidene]-(2,6-dimethylphenyl)azanium |
| SMILES | C=CC(=O)OCCOC(=O)c1ccccc1-c1c2cc/c(=[NH+]\c3c(C)cccc3C)cc-2oc2cc(Nc3c(C)cccc3C)ccc12 |
| InChI | InChI=1S/C41H36N2O5/c1-6-37(44)46-21-22-47-41(45)32-16-8-7-15-31(32)38-33-19-17-29(42-39-25(2)11-9-12-26(39)3)23-35(33)48-36-24-30(18-20-34(36)38)43-40-27(4)13-10-14-28(40)5/h6-20,23-24,42H,1,21-22H2,2-5H3/p+1/b43-30+ |
| InChIKey | XEZKIVUQOZSUFC-BJSJXSMNSA-O |
| XLogP | 7.38 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.76 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|