C50H58N2O3 — CID 122683304
methyl 2-[3-(2,6-dibutylanilino)-6-(2,6-dibutylphenyl)iminoxanthen-9-yl]-4-methylbenzoate (PubChem CID 122683304) has the molecular formula C50H58N2O3 and a molecular weight of 735.02 g/mol. Its IUPAC name is methyl 2-[3-(2,6-dibutylanilino)-6-(2,6-dibutylphenyl)iminoxanthen-9-yl]-4-methylbenzoate.
| Compound Name | methyl 2-[3-(2,6-dibutylanilino)-6-(2,6-dibutylphenyl)iminoxanthen-9-yl]-4-methylbenzoate |
|---|---|
| PubChem CID | 122683304 |
| Molecular Formula | C50H58N2O3 |
| Molecular Weight | 735.02 g/mol |
| Exact Mass | 734.44 |
| IUPAC Name | methyl 2-[3-(2,6-dibutylanilino)-6-(2,6-dibutylphenyl)iminoxanthen-9-yl]-4-methylbenzoate |
| SMILES | CCCCc1cccc(CCCC)c1/N=c1\ccc2c(-c3cc(C)ccc3C(=O)OC)c3ccc(Nc4c(CCCC)cccc4CCCC)cc3oc-2c1 |
| InChI | InChI=1S/C50H58N2O3/c1-7-11-17-35-21-15-22-36(18-12-8-2)48(35)51-39-26-29-42-45(32-39)55-46-33-40(52-49-37(19-13-9-3)23-16-24-38(49)20-14-10-4)27-30-43(46)47(42)44-31-34(5)25-28-41(44)50(53)54-6/h15-16,21-33,51H,7-14,17-20H2,1-6H3/b52-40+ |
| InChIKey | YAOXWJJKJGJVEE-XPZUOBEZSA-N |
| XLogP | 13.65 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.02 |
| LogP ≤ 5 | 13.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|