C37H36N2O — CID 144542670
N-(2,6-dimethylphenyl)-6-(2,6-dimethylphenyl)imino-9-[(3E,5Z)-5-methylhepta-1,3,5-trien-4-yl]xanthen-3-amine (PubChem CID 144542670) has the molecular formula C37H36N2O and a molecular weight of 524.71 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-6-(2,6-dimethylphenyl)imino-9-[(3E,5Z)-5-methylhepta-1,3,5-trien-4-yl]xanthen-3-amine.
| Compound Name | N-(2,6-dimethylphenyl)-6-(2,6-dimethylphenyl)imino-9-[(3E,5Z)-5-methylhepta-1,3,5-trien-4-yl]xanthen-3-amine |
|---|---|
| PubChem CID | 144542670 |
| Molecular Formula | C37H36N2O |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | N-(2,6-dimethylphenyl)-6-(2,6-dimethylphenyl)imino-9-[(3E,5Z)-5-methylhepta-1,3,5-trien-4-yl]xanthen-3-amine |
| SMILES | C=C/C=C(C(\C)=C/C)/c1c2cc/c(=N\c3c(C)cccc3C)cc-2oc2cc(Nc3c(C)cccc3C)ccc12 |
| InChI | InChI=1S/C37H36N2O/c1-8-12-30(23(3)9-2)35-31-19-17-28(38-36-24(4)13-10-14-25(36)5)21-33(31)40-34-22-29(18-20-32(34)35)39-37-26(6)15-11-16-27(37)7/h8-22,38H,1H2,2-7H3/b23-9-,30-12+,39-29+ |
| InChIKey | HILOCECFTPFURT-PUOBDSIVSA-N |
| XLogP | 10.28 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|