C39H38N2O10S3 — CID 159580323
2-[3-(3-methoxysulfonyl-2,4,6-trimethylphenyl)imino-6-[2,4,6-trimethyl-3-(sulfomethyl)anilino]xanthen-9-yl]benzenesulfonic acid (PubChem CID 159580323) has the molecular formula C39H38N2O10S3 and a molecular weight of 790.94 g/mol. Its IUPAC name is 2-[3-(3-methoxysulfonyl-2,4,6-trimethylphenyl)imino-6-[2,4,6-trimethyl-3-(sulfomethyl)anilino]xanthen-9-yl]benzenesulfonic acid.
| Compound Name | 2-[3-(3-methoxysulfonyl-2,4,6-trimethylphenyl)imino-6-[2,4,6-trimethyl-3-(sulfomethyl)anilino]xanthen-9-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 159580323 |
| Molecular Formula | C39H38N2O10S3 |
| Molecular Weight | 790.94 g/mol |
| Exact Mass | 790.17 |
| IUPAC Name | 2-[3-(3-methoxysulfonyl-2,4,6-trimethylphenyl)imino-6-[2,4,6-trimethyl-3-(sulfomethyl)anilino]xanthen-9-yl]benzenesulfonic acid |
| SMILES | COS(=O)(=O)c1c(C)cc(C)c(/N=c2\ccc3c(-c4ccccc4S(=O)(=O)O)c4ccc(Nc5c(C)cc(C)c(CS(=O)(=O)O)c5C)cc4oc-3c2)c1C |
| InChI | InChI=1S/C39H38N2O10S3/c1-21-16-22(2)37(25(5)32(21)20-52(42,43)44)40-27-12-14-29-33(18-27)51-34-19-28(41-38-23(3)17-24(4)39(26(38)6)54(48,49)50-7)13-15-30(34)36(29)31-10-8-9-11-35(31)53(45,46)47/h8-19,40H,20H2,1-7H3,(H,42,43,44)(H,45,46,47)/b41-28+ |
| InChIKey | GLKDQRAHMJVTAK-SISPBFPDSA-N |
| XLogP | 8.00 |
| TPSA | 189.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.94 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|