C45H47N4O6S- — CID 140877198
2-[3-[2,4,6-trimethyl-3-(2-methylpropanoylamino)anilino]-6-[2,4,6-trimethyl-3-(2-methylpropanoylamino)phenyl]iminoxanthen-9-yl]benzenesulfonate (PubChem CID 140877198) has the molecular formula C45H47N4O6S- and a molecular weight of 771.96 g/mol. Its IUPAC name is 2-[3-[2,4,6-trimethyl-3-(2-methylpropanoylamino)anilino]-6-[2,4,6-trimethyl-3-(2-methylpropanoylamino)phenyl]iminoxanthen-9-yl]benzenesulfonate.
| Compound Name | 2-[3-[2,4,6-trimethyl-3-(2-methylpropanoylamino)anilino]-6-[2,4,6-trimethyl-3-(2-methylpropanoylamino)phenyl]iminoxanthen-9-yl]benzenesulfonate |
|---|---|
| PubChem CID | 140877198 |
| Molecular Formula | C45H47N4O6S- |
| Molecular Weight | 771.96 g/mol |
| Exact Mass | 771.32 |
| IUPAC Name | 2-[3-[2,4,6-trimethyl-3-(2-methylpropanoylamino)anilino]-6-[2,4,6-trimethyl-3-(2-methylpropanoylamino)phenyl]iminoxanthen-9-yl]benzenesulfonate |
| SMILES | Cc1cc(C)c(NC(=O)C(C)C)c(C)c1/N=c1\ccc2c(-c3ccccc3S(=O)(=O)[O-])c3ccc(Nc4c(C)cc(C)c(NC(=O)C(C)C)c4C)cc3oc-2c1 |
| InChI | InChI=1S/C45H48N4O6S/c1-23(2)44(50)48-42-27(7)19-25(5)40(29(42)9)46-31-15-17-33-36(21-31)55-37-22-32(16-18-34(37)39(33)35-13-11-12-14-38(35)56(52,53)54)47-41-26(6)20-28(8)43(30(41)10)49-45(51)24(3)4/h11-24,46H,1-10H3,(H,48,50)(H,49,51)(H,52,53,54)/p-1/b47-32+ |
| InChIKey | PMJOHUOYGXSTCQ-IUQVKIOSSA-M |
| XLogP | 10.12 |
| TPSA | 152.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.96 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|