C38H33N2NaO6S — CID 23693576
sodium 3-[[9-(2-carboxyphenyl)-6-(2,4,6-trimethylphenyl)iminoxanthen-3-yl]amino]-2,4,6-trimethylbenzenesulfonate (PubChem CID 23693576) has the molecular formula C38H33N2NaO6S and a molecular weight of 668.75 g/mol. Its IUPAC name is sodium 3-[[9-(2-carboxyphenyl)-6-(2,4,6-trimethylphenyl)iminoxanthen-3-yl]amino]-2,4,6-trimethylbenzenesulfonate.
| Compound Name | sodium 3-[[9-(2-carboxyphenyl)-6-(2,4,6-trimethylphenyl)iminoxanthen-3-yl]amino]-2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 23693576 |
| Molecular Formula | C38H33N2NaO6S |
| Molecular Weight | 668.75 g/mol |
| Exact Mass | 668.20 |
| IUPAC Name | sodium 3-[[9-(2-carboxyphenyl)-6-(2,4,6-trimethylphenyl)iminoxanthen-3-yl]amino]-2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(/N=c2\ccc3c(-c4ccccc4C(=O)O)c4ccc(Nc5c(C)cc(C)c(S(=O)(=O)[O-])c5C)cc4oc-3c2)c(C)c1.[Na+] |
| InChI | InChI=1S/C38H34N2O6S.Na/c1-20-15-21(2)35(22(3)16-20)39-26-11-13-30-32(18-26)46-33-19-27(40-36-23(4)17-24(5)37(25(36)6)47(43,44)45)12-14-31(33)34(30)28-9-7-8-10-29(28)38(41)42;/h7-19,40H,1-6H3,(H,41,42)(H,43,44,45);/q;+1/p-1/b39-26+; |
| InChIKey | RBXSLNRUISUYOG-NDRPFHGCSA-M |
| XLogP | 5.64 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.75 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|