C24H12F6N2O5 — CID 20771807
2-[3-[(2,2,2-trifluoroacetyl)amino]-6-(2,2,2-trifluoroacetyl)iminoxanthen-9-yl]benzoic acid (PubChem CID 20771807) has the molecular formula C24H12F6N2O5 and a molecular weight of 522.36 g/mol. Its IUPAC name is 2-[3-[(2,2,2-trifluoroacetyl)amino]-6-(2,2,2-trifluoroacetyl)iminoxanthen-9-yl]benzoic acid.
| Compound Name | 2-[3-[(2,2,2-trifluoroacetyl)amino]-6-(2,2,2-trifluoroacetyl)iminoxanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 20771807 |
| Molecular Formula | C24H12F6N2O5 |
| Molecular Weight | 522.36 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | 2-[3-[(2,2,2-trifluoroacetyl)amino]-6-(2,2,2-trifluoroacetyl)iminoxanthen-9-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1c2cc/c(=N\C(=O)C(F)(F)F)cc-2oc2cc(NC(=O)C(F)(F)F)ccc12 |
| InChI | InChI=1S/C24H12F6N2O5/c25-23(26,27)21(35)31-11-5-7-15-17(9-11)37-18-10-12(32-22(36)24(28,29)30)6-8-16(18)19(15)13-3-1-2-4-14(13)20(33)34/h1-10H,(H,31,35)(H,33,34)/b32-12+ |
| InChIKey | OEKPDVPEOIMWQO-DPWJMMOYSA-N |
| XLogP | 5.39 |
| TPSA | 108.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.36 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|