C26H27N2O5+ — CID 54134167
[9-(2-carboxyphenyl)-6-[(3,3-dihydroxy-2-methylpropyl)amino]xanthen-3-ylidene]-dimethylazanium (PubChem CID 54134167) has the molecular formula C26H27N2O5+ and a molecular weight of 447.51 g/mol. Its IUPAC name is [9-(2-carboxyphenyl)-6-[(3,3-dihydroxy-2-methylpropyl)amino]xanthen-3-ylidene]-dimethylazanium.
| Compound Name | [9-(2-carboxyphenyl)-6-[(3,3-dihydroxy-2-methylpropyl)amino]xanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 54134167 |
| Molecular Formula | C26H27N2O5+ |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | [9-(2-carboxyphenyl)-6-[(3,3-dihydroxy-2-methylpropyl)amino]xanthen-3-ylidene]-dimethylazanium |
| SMILES | CC(CNc1ccc2c(-c3ccccc3C(=O)O)c3ccc(=[N+](C)C)cc-3oc2c1)C(O)O |
| InChI | InChI=1S/C26H26N2O5/c1-15(25(29)30)14-27-16-8-10-20-22(12-16)33-23-13-17(28(2)3)9-11-21(23)24(20)18-6-4-5-7-19(18)26(31)32/h4-13,15,25,29-30H,14H2,1-3H3,(H,31,32)/p+1 |
| InChIKey | XEBYSPWDWYUXRE-UHFFFAOYSA-O |
| XLogP | 3.29 |
| TPSA | 105.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|