C24H20O4 — CID 135251123
2-(3-tert-butyl-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 135251123) has the molecular formula C24H20O4 and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-(3-tert-butyl-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 2-(3-tert-butyl-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 135251123 |
| Molecular Formula | C24H20O4 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 2-(3-tert-butyl-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | CC(C)(C)c1ccc2c(-c3ccccc3C(=O)O)c3ccc(=O)cc-3oc2c1 |
| InChI | InChI=1S/C24H20O4/c1-24(2,3)14-8-10-18-20(12-14)28-21-13-15(25)9-11-19(21)22(18)16-6-4-5-7-17(16)23(26)27/h4-13H,1-3H3,(H,26,27) |
| InChIKey | FWTGDGXUNLLCNL-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|