C40H24O10 — CID 87668119
3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 87668119) has the molecular formula C40H24O10 and a molecular weight of 664.62 g/mol. Its IUPAC name is 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 87668119 |
| Molecular Formula | C40H24O10 |
| Molecular Weight | 664.62 g/mol |
| Exact Mass | 664.14 |
| IUPAC Name | 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1c2ccc(=O)cc-2oc2cc(O)ccc12.O=C1OC2(c3ccc(O)cc3Oc3cc(O)ccc32)c2ccccc21 |
| InChI | InChI=1S/2C20H12O5/c21-11-5-7-15-17(9-11)24-18-10-12(22)6-8-16(18)20(15)14-4-2-1-3-13(14)19(23)25-20;21-11-5-7-15-17(9-11)25-18-10-12(22)6-8-16(18)19(15)13-3-1-2-4-14(13)20(23)24/h1-10,21-22H;1-10,21H,(H,23,24) |
| InChIKey | RACFBGYJTRQGLA-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 163.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.62 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|