C42H37N2O6+ — CID 177476255
[(1S)-14'-(2-carboxyphenyl)-9'-(diethylamino)-3-oxospiro[2-benzofuran-1,12'-chromeno[3,2-b]xanthene]-3'-ylidene]-diethylazanium (PubChem CID 177476255) has the molecular formula C42H37N2O6+ and a molecular weight of 665.77 g/mol. Its IUPAC name is [(1S)-14'-(2-carboxyphenyl)-9'-(diethylamino)-3-oxospiro[2-benzofuran-1,12'-chromeno[3,2-b]xanthene]-3'-ylidene]-diethylazanium.
| Compound Name | [(1S)-14'-(2-carboxyphenyl)-9'-(diethylamino)-3-oxospiro[2-benzofuran-1,12'-chromeno[3,2-b]xanthene]-3'-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 177476255 |
| Molecular Formula | C42H37N2O6+ |
| Molecular Weight | 665.77 g/mol |
| Exact Mass | 665.26 |
| IUPAC Name | [(1S)-14'-(2-carboxyphenyl)-9'-(diethylamino)-3-oxospiro[2-benzofuran-1,12'-chromeno[3,2-b]xanthene]-3'-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc3oc4cc(=[N+](CC)CC)ccc-4c(-c4ccccc4C(=O)O)c3cc1[C@@]21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C42H36N2O6/c1-5-43(6-2)25-17-19-30-35(21-25)48-36-24-38-34(23-31(36)39(30)27-13-9-10-14-28(27)40(45)46)42(32-16-12-11-15-29(32)41(47)50-42)33-20-18-26(22-37(33)49-38)44(7-3)8-4/h9-24H,5-8H2,1-4H3/p+1/t42-/m0/s1 |
| InChIKey | ZNUDJKFPFIIPBT-WBCKFURZSA-O |
| XLogP | 8.13 |
| TPSA | 92.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.77 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|