C26H18O6 — CID 70117084
3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;phenol (PubChem CID 70117084) has the molecular formula C26H18O6 and a molecular weight of 426.42 g/mol. Its IUPAC name is 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;phenol.
| Compound Name | 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;phenol |
|---|---|
| PubChem CID | 70117084 |
| Molecular Formula | C26H18O6 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;phenol |
| SMILES | O=C1OC2(c3ccc(O)cc3Oc3cc(O)ccc32)c2ccccc21.Oc1ccccc1 |
| InChI | InChI=1S/C20H12O5.C6H6O/c21-11-5-7-15-17(9-11)24-18-10-12(22)6-8-16(18)20(15)14-4-2-1-3-13(14)19(23)25-20;7-6-4-2-1-3-5-6/h1-10,21-22H;1-5,7H |
| InChIKey | RDVBMBKZSHAFIW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |