C20H12CdO5 — CID 174867463
cadmium;3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 174867463) has the molecular formula C20H12CdO5 and a molecular weight of 444.72 g/mol. Its IUPAC name is cadmium;3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | cadmium;3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 174867463 |
| Molecular Formula | C20H12CdO5 |
| Molecular Weight | 444.72 g/mol |
| Exact Mass | 445.97 |
| IUPAC Name | cadmium;3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | O=C1OC2(c3ccc(O)cc3Oc3cc(O)ccc32)c2ccccc21.[Cd] |
| InChI | InChI=1S/C20H12O5.Cd/c21-11-5-7-15-17(9-11)24-18-10-12(22)6-8-16(18)20(15)14-4-2-1-3-13(14)19(23)25-20;/h1-10,21-22H; |
| InChIKey | HGZYWIGAETYWBF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.72 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |