C25H24O6 — CID 145053432
5-acetyl-2-(3-oxoxanthen-9-yl)benzoic acid;ethane;methanol (PubChem CID 145053432) has the molecular formula C25H24O6 and a molecular weight of 420.46 g/mol. Its IUPAC name is 5-acetyl-2-(3-oxoxanthen-9-yl)benzoic acid;ethane;methanol.
| Compound Name | 5-acetyl-2-(3-oxoxanthen-9-yl)benzoic acid;ethane;methanol |
|---|---|
| PubChem CID | 145053432 |
| Molecular Formula | C25H24O6 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 5-acetyl-2-(3-oxoxanthen-9-yl)benzoic acid;ethane;methanol |
| SMILES | CC.CC(=O)c1ccc(-c2c3ccc(=O)cc-3oc3ccccc23)c(C(=O)O)c1.CO |
| InChI | InChI=1S/C22H14O5.C2H6.CH4O/c1-12(23)13-6-8-15(18(10-13)22(25)26)21-16-4-2-3-5-19(16)27-20-11-14(24)7-9-17(20)21;2*1-2/h2-11H,1H3,(H,25,26);1-2H3;2H,1H3 |
| InChIKey | FZFIBIPYFTYJSP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|