C30H20Br2O7 — CID 102160110
5-[[3,5-bis(bromomethyl)phenyl]methoxycarbonyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 102160110) has the molecular formula C30H20Br2O7 and a molecular weight of 652.29 g/mol. Its IUPAC name is 5-[[3,5-bis(bromomethyl)phenyl]methoxycarbonyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[[3,5-bis(bromomethyl)phenyl]methoxycarbonyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 102160110 |
| Molecular Formula | C30H20Br2O7 |
| Molecular Weight | 652.29 g/mol |
| Exact Mass | 649.96 |
| IUPAC Name | 5-[[3,5-bis(bromomethyl)phenyl]methoxycarbonyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | O=C(OCc1cc(CBr)cc(CBr)c1)c1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C30H20Br2O7/c31-13-16-7-17(14-32)9-18(8-16)15-38-30(37)19-1-4-22(25(10-19)29(35)36)28-23-5-2-20(33)11-26(23)39-27-12-21(34)3-6-24(27)28/h1-12,33H,13-15H2,(H,35,36) |
| InChIKey | CLGOOEGMBADBQT-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.29 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|