C23H16O5S — CID 58446078
2-(3-hydroxy-6-oxoxanthen-9-yl)-5-(2-sulfanylidenepropyl)benzoic acid (PubChem CID 58446078) has the molecular formula C23H16O5S and a molecular weight of 404.44 g/mol. Its IUPAC name is 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-(2-sulfanylidenepropyl)benzoic acid.
| Compound Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-(2-sulfanylidenepropyl)benzoic acid |
|---|---|
| PubChem CID | 58446078 |
| Molecular Formula | C23H16O5S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-(2-sulfanylidenepropyl)benzoic acid |
| SMILES | CC(=S)Cc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C23H16O5S/c1-12(29)8-13-2-5-16(19(9-13)23(26)27)22-17-6-3-14(24)10-20(17)28-21-11-15(25)4-7-18(21)22/h2-7,9-11,24H,8H2,1H3,(H,26,27) |
| InChIKey | WXRTZQIKJFRBQN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|