C23H19FINO5S — CID 159137947
5-(ethanethioylamino)-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid;fluoro-methyl-tritio-λ3-iodane (PubChem CID 159137947) has the molecular formula C23H19FINO5S and a molecular weight of 569.38 g/mol. Its IUPAC name is 5-(ethanethioylamino)-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid;fluoro-methyl-tritio-λ3-iodane.
| Compound Name | 5-(ethanethioylamino)-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid;fluoro-methyl-tritio-λ3-iodane |
|---|---|
| PubChem CID | 159137947 |
| Molecular Formula | C23H19FINO5S |
| Molecular Weight | 569.38 g/mol |
| Exact Mass | 569.01 |
| IUPAC Name | 5-(ethanethioylamino)-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid;fluoro-methyl-tritio-λ3-iodane |
| SMILES | CC(=S)Nc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1.[3H]I(C)F |
| InChI | InChI=1S/C22H15NO5S.CH4FI/c1-11(29)23-12-2-5-15(18(8-12)22(26)27)21-16-6-3-13(24)9-19(16)28-20-10-14(25)4-7-17(20)21;1-3-2/h2-10,24H,1H3,(H,23,29)(H,26,27);3H,1H3/i;3T |
| InChIKey | KHSRURJYOXHDSA-LXUHVUQPSA-N |
| XLogP | 5.93 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.38 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|