C27H26N2O6S — CID 170197478
2-(3-hydroxy-6-oxoxanthen-9-yl)-5-(3-methylbutoxymethylcarbamothioylamino)benzoic acid (PubChem CID 170197478) has the molecular formula C27H26N2O6S and a molecular weight of 506.58 g/mol. Its IUPAC name is 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-(3-methylbutoxymethylcarbamothioylamino)benzoic acid.
| Compound Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-(3-methylbutoxymethylcarbamothioylamino)benzoic acid |
|---|---|
| PubChem CID | 170197478 |
| Molecular Formula | C27H26N2O6S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-(3-methylbutoxymethylcarbamothioylamino)benzoic acid |
| SMILES | CC(C)CCOCNC(=S)Nc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C27H26N2O6S/c1-15(2)9-10-34-14-28-27(36)29-16-3-6-19(22(11-16)26(32)33)25-20-7-4-17(30)12-23(20)35-24-13-18(31)5-8-21(24)25/h3-8,11-13,15,30H,9-10,14H2,1-2H3,(H,32,33)(H2,28,29,36) |
| InChIKey | BBLYKMGFVUGDIW-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 121.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|