C32H33N3O9S — CID 132582687
5-[[(5S)-5-carboxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]carbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 132582687) has the molecular formula C32H33N3O9S and a molecular weight of 635.70 g/mol. Its IUPAC name is 5-[[(5S)-5-carboxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]carbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[[(5S)-5-carboxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]carbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 132582687 |
| Molecular Formula | C32H33N3O9S |
| Molecular Weight | 635.70 g/mol |
| Exact Mass | 635.19 |
| IUPAC Name | 5-[[(5S)-5-carboxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]carbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCNC(=S)Nc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1)C(=O)O |
| InChI | InChI=1S/C32H33N3O9S/c1-32(2,3)44-31(42)35-24(29(40)41)6-4-5-13-33-30(45)34-17-7-10-20(23(14-17)28(38)39)27-21-11-8-18(36)15-25(21)43-26-16-19(37)9-12-22(26)27/h7-12,14-16,24,36H,4-6,13H2,1-3H3,(H,35,42)(H,38,39)(H,40,41)(H2,33,34,45)/t24-/m0/s1 |
| InChIKey | PVBFRVVKCZQCHO-DEOSSOPVSA-N |
| XLogP | 5.40 |
| TPSA | 187.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.70 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|