C28H27N3O6S — CID 20719175
2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[[6-(methylamino)-6-oxohexyl]carbamothioylamino]benzoic acid (PubChem CID 20719175) has the molecular formula C28H27N3O6S and a molecular weight of 533.61 g/mol. Its IUPAC name is 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[[6-(methylamino)-6-oxohexyl]carbamothioylamino]benzoic acid.
| Compound Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[[6-(methylamino)-6-oxohexyl]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 20719175 |
| Molecular Formula | C28H27N3O6S |
| Molecular Weight | 533.61 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[[6-(methylamino)-6-oxohexyl]carbamothioylamino]benzoic acid |
| SMILES | CNC(=O)CCCCCNC(=S)Nc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C28H27N3O6S/c1-29-25(34)5-3-2-4-12-30-28(38)31-16-6-9-19(22(13-16)27(35)36)26-20-10-7-17(32)14-23(20)37-24-15-18(33)8-11-21(24)26/h6-11,13-15,32H,2-5,12H2,1H3,(H,29,34)(H,35,36)(H2,30,31,38) |
| InChIKey | XWTLQCFLLAWVDA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 140.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.61 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|