C27H27N3O5S — CID 162778741
5-(6-aminohexylcarbamothioylamino)-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 162778741) has the molecular formula C27H27N3O5S and a molecular weight of 505.60 g/mol. Its IUPAC name is 5-(6-aminohexylcarbamothioylamino)-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-(6-aminohexylcarbamothioylamino)-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 162778741 |
| Molecular Formula | C27H27N3O5S |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | 5-(6-aminohexylcarbamothioylamino)-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | NCCCCCCNC(=S)Nc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C27H27N3O5S/c28-11-3-1-2-4-12-29-27(36)30-16-5-8-19(22(13-16)26(33)34)25-20-9-6-17(31)14-23(20)35-24-15-18(32)7-10-21(24)25/h5-10,13-15,31H,1-4,11-12,28H2,(H,33,34)(H2,29,30,36) |
| InChIKey | OAUZGOKKLDVPNG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|