C35H31N3O10S — CID 59903599
5-[[5-[(3,4-dihydroxybenzoyl)amino]-6-methoxy-6-oxohexyl]carbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 59903599) has the molecular formula C35H31N3O10S and a molecular weight of 685.71 g/mol. Its IUPAC name is 5-[[5-[(3,4-dihydroxybenzoyl)amino]-6-methoxy-6-oxohexyl]carbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[[5-[(3,4-dihydroxybenzoyl)amino]-6-methoxy-6-oxohexyl]carbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 59903599 |
| Molecular Formula | C35H31N3O10S |
| Molecular Weight | 685.71 g/mol |
| Exact Mass | 685.17 |
| IUPAC Name | 5-[[5-[(3,4-dihydroxybenzoyl)amino]-6-methoxy-6-oxohexyl]carbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | COC(=O)C(CCCCNC(=S)Nc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1)NC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C35H31N3O10S/c1-47-34(46)26(38-32(43)18-5-12-27(41)28(42)14-18)4-2-3-13-36-35(49)37-19-6-9-22(25(15-19)33(44)45)31-23-10-7-20(39)16-29(23)48-30-17-21(40)8-11-24(30)31/h5-12,14-17,26,39,41-42H,2-4,13H2,1H3,(H,38,43)(H,44,45)(H2,36,37,49) |
| InChIKey | LZUYNCHPNCWYDR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 207.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.71 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|