C43H37N3O12S — CID 101259212
5-[[1-[(4-acetylphenyl)methoxy]-1-oxo-6-[(4-sulfamoylbenzoyl)amino]hexan-2-yl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 101259212) has the molecular formula C43H37N3O12S and a molecular weight of 819.85 g/mol. Its IUPAC name is 5-[[1-[(4-acetylphenyl)methoxy]-1-oxo-6-[(4-sulfamoylbenzoyl)amino]hexan-2-yl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[[1-[(4-acetylphenyl)methoxy]-1-oxo-6-[(4-sulfamoylbenzoyl)amino]hexan-2-yl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 101259212 |
| Molecular Formula | C43H37N3O12S |
| Molecular Weight | 819.85 g/mol |
| Exact Mass | 819.21 |
| IUPAC Name | 5-[[1-[(4-acetylphenyl)methoxy]-1-oxo-6-[(4-sulfamoylbenzoyl)amino]hexan-2-yl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | CC(=O)c1ccc(COC(=O)C(CCCCNC(=O)c2ccc(S(N)(=O)=O)cc2)NC(=O)c2ccc(-c3c4ccc(=O)cc-4oc4cc(O)ccc34)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C43H37N3O12S/c1-24(47)26-7-5-25(6-8-26)23-57-43(54)36(4-2-3-19-45-40(50)27-9-14-31(15-10-27)59(44,55)56)46-41(51)28-11-16-32(35(20-28)42(52)53)39-33-17-12-29(48)21-37(33)58-38-22-30(49)13-18-34(38)39/h5-18,20-22,36,48H,2-4,19,23H2,1H3,(H,45,50)(H,46,51)(H,52,53)(H2,44,55,56) |
| InChIKey | PPDVMPDALYSZQC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 249.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.85 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|