C37H28N2O12 — CID 102014807
4-[[5-carboxy-5-[(7-hydroxy-2-oxochromene-3-carbonyl)amino]pentyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 102014807) has the molecular formula C37H28N2O12 and a molecular weight of 692.63 g/mol. Its IUPAC name is 4-[[5-carboxy-5-[(7-hydroxy-2-oxochromene-3-carbonyl)amino]pentyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 4-[[5-carboxy-5-[(7-hydroxy-2-oxochromene-3-carbonyl)amino]pentyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 102014807 |
| Molecular Formula | C37H28N2O12 |
| Molecular Weight | 692.63 g/mol |
| Exact Mass | 692.16 |
| IUPAC Name | 4-[[5-carboxy-5-[(7-hydroxy-2-oxochromene-3-carbonyl)amino]pentyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | O=C(NCCCCC(NC(=O)c1cc2ccc(O)cc2oc1=O)C(=O)O)c1ccc(C(=O)O)c(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c1 |
| InChI | InChI=1S/C37H28N2O12/c40-20-6-4-18-13-27(37(49)51-29(18)15-20)34(44)39-28(36(47)48)3-1-2-12-38-33(43)19-5-9-23(35(45)46)26(14-19)32-24-10-7-21(41)16-30(24)50-31-17-22(42)8-11-25(31)32/h4-11,13-17,28,40-41H,1-3,12H2,(H,38,43)(H,39,44)(H,45,46)(H,47,48) |
| InChIKey | MJNCGDHIUDTXSG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 233.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.63 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|