C31H22ClNO7 — CID 10196534
4-[(4-chloro-3-oxo-1-phenylbutan-2-yl)carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 10196534) has the molecular formula C31H22ClNO7 and a molecular weight of 555.97 g/mol. Its IUPAC name is 4-[(4-chloro-3-oxo-1-phenylbutan-2-yl)carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 4-[(4-chloro-3-oxo-1-phenylbutan-2-yl)carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 10196534 |
| Molecular Formula | C31H22ClNO7 |
| Molecular Weight | 555.97 g/mol |
| Exact Mass | 555.11 |
| IUPAC Name | 4-[(4-chloro-3-oxo-1-phenylbutan-2-yl)carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)CCl)c1ccc(C(=O)O)c(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c1 |
| InChI | InChI=1S/C31H22ClNO7/c32-16-26(36)25(12-17-4-2-1-3-5-17)33-30(37)18-6-9-21(31(38)39)24(13-18)29-22-10-7-19(34)14-27(22)40-28-15-20(35)8-11-23(28)29/h1-11,13-15,25,34H,12,16H2,(H,33,37)(H,38,39) |
| InChIKey | IAWVXBKYJIOZEE-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.97 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|