C39H31NO10 — CID 166798987
5-[[1-carboxy-2-[4-(4-hydroxy-3-methylphenoxy)-3,5-dimethylphenyl]ethyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 166798987) has the molecular formula C39H31NO10 and a molecular weight of 673.67 g/mol. Its IUPAC name is 5-[[1-carboxy-2-[4-(4-hydroxy-3-methylphenoxy)-3,5-dimethylphenyl]ethyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[[1-carboxy-2-[4-(4-hydroxy-3-methylphenoxy)-3,5-dimethylphenyl]ethyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 166798987 |
| Molecular Formula | C39H31NO10 |
| Molecular Weight | 673.67 g/mol |
| Exact Mass | 673.19 |
| IUPAC Name | 5-[[1-carboxy-2-[4-(4-hydroxy-3-methylphenoxy)-3,5-dimethylphenyl]ethyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | Cc1cc(Oc2c(C)cc(CC(NC(=O)c3ccc(-c4c5ccc(=O)cc-5oc5cc(O)ccc45)c(C(=O)O)c3)C(=O)O)cc2C)ccc1O |
| InChI | InChI=1S/C39H31NO10/c1-19-14-26(7-11-32(19)43)49-36-20(2)12-22(13-21(36)3)15-31(39(47)48)40-37(44)23-4-8-27(30(16-23)38(45)46)35-28-9-5-24(41)17-33(28)50-34-18-25(42)6-10-29(34)35/h4-14,16-18,31,41,43H,15H2,1-3H3,(H,40,44)(H,45,46)(H,47,48) |
| InChIKey | YEVZEFHRZVIHFK-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 183.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.67 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|