C21H13NO5S — CID 156714542
2-(3-hydroxy-6-oxoxanthen-9-yl)-4-(methanethioylamino)benzoic acid (PubChem CID 156714542) has the molecular formula C21H13NO5S and a molecular weight of 391.40 g/mol. Its IUPAC name is 2-(3-hydroxy-6-oxoxanthen-9-yl)-4-(methanethioylamino)benzoic acid.
| Compound Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-4-(methanethioylamino)benzoic acid |
|---|---|
| PubChem CID | 156714542 |
| Molecular Formula | C21H13NO5S |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-4-(methanethioylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(NC=S)cc1-c1c2ccc(=O)cc-2oc2cc(O)ccc12 |
| InChI | InChI=1S/C21H13NO5S/c23-12-2-5-15-18(8-12)27-19-9-13(24)3-6-16(19)20(15)17-7-11(22-10-28)1-4-14(17)21(25)26/h1-10,23H,(H,22,28)(H,25,26) |
| InChIKey | MGQFGDADYGUVQS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|