C28H26N2O7S — CID 11981649
2-(3-hydroxy-6-oxoxanthen-9-yl)-4-[[2-[3-oxo-3-(propylamino)propyl]sulfanylacetyl]amino]benzoic acid (PubChem CID 11981649) has the molecular formula C28H26N2O7S and a molecular weight of 534.59 g/mol. Its IUPAC name is 2-(3-hydroxy-6-oxoxanthen-9-yl)-4-[[2-[3-oxo-3-(propylamino)propyl]sulfanylacetyl]amino]benzoic acid.
| Compound Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-4-[[2-[3-oxo-3-(propylamino)propyl]sulfanylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 11981649 |
| Molecular Formula | C28H26N2O7S |
| Molecular Weight | 534.59 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-4-[[2-[3-oxo-3-(propylamino)propyl]sulfanylacetyl]amino]benzoic acid |
| SMILES | CCCNC(=O)CCSCC(=O)Nc1ccc(C(=O)O)c(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c1 |
| InChI | InChI=1S/C28H26N2O7S/c1-2-10-29-25(33)9-11-38-15-26(34)30-16-3-6-19(28(35)36)22(12-16)27-20-7-4-17(31)13-23(20)37-24-14-18(32)5-8-21(24)27/h3-8,12-14,31H,2,9-11,15H2,1H3,(H,29,33)(H,30,34)(H,35,36) |
| InChIKey | DJTLNHBGCBFQMU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 145.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|