C34H38N2O7S — CID 101134465
2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[[2-[(2-oxo-12-sulfanyldodecyl)amino]acetyl]amino]benzoic acid (PubChem CID 101134465) has the molecular formula C34H38N2O7S and a molecular weight of 618.75 g/mol. Its IUPAC name is 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[[2-[(2-oxo-12-sulfanyldodecyl)amino]acetyl]amino]benzoic acid.
| Compound Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[[2-[(2-oxo-12-sulfanyldodecyl)amino]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 101134465 |
| Molecular Formula | C34H38N2O7S |
| Molecular Weight | 618.75 g/mol |
| Exact Mass | 618.24 |
| IUPAC Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[[2-[(2-oxo-12-sulfanyldodecyl)amino]acetyl]amino]benzoic acid |
| SMILES | O=C(CCCCCCCCCCS)CNCC(=O)Nc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C34H38N2O7S/c37-23-11-14-27-30(18-23)43-31-19-24(38)12-15-28(31)33(27)26-13-10-22(17-29(26)34(41)42)36-32(40)21-35-20-25(39)9-7-5-3-1-2-4-6-8-16-44/h10-15,17-19,35,37,44H,1-9,16,20-21H2,(H,36,40)(H,41,42) |
| InChIKey | RNCNOLVYTPVSLL-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 145.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.75 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|