C27H19AsN2O7S — CID 140666457
5-[(4-dihydroxyarsanylphenyl)carbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 140666457) has the molecular formula C27H19AsN2O7S and a molecular weight of 590.45 g/mol. Its IUPAC name is 5-[(4-dihydroxyarsanylphenyl)carbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[(4-dihydroxyarsanylphenyl)carbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 140666457 |
| Molecular Formula | C27H19AsN2O7S |
| Molecular Weight | 590.45 g/mol |
| Exact Mass | 590.01 |
| IUPAC Name | 5-[(4-dihydroxyarsanylphenyl)carbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | O=C(O)c1cc(NC(=S)Nc2ccc([As](O)O)cc2)ccc1-c1c2ccc(=O)cc-2oc2cc(O)ccc12 |
| InChI | InChI=1S/C27H19AsN2O7S/c31-17-6-9-20-23(12-17)37-24-13-18(32)7-10-21(24)25(20)19-8-5-16(11-22(19)26(33)34)30-27(38)29-15-3-1-14(2-4-15)28(35)36/h1-13,31,35-36H,(H,33,34)(H2,29,30,38) |
| InChIKey | BDLOZQJTRDVBRC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 152.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|